tetraethyl pyrophosphate


TEPP; tetraethyl pyrophosphate
CAS RN:[107-49-3]
Formula:C8H20O7P2; 290.19 g/mol
InChiKey:IDCBOTIENDVCBQ-UHFFFAOYSA-N
SMILES:CCO[P](=O)(OCC)O[P](=O)(OCC)OCC
Molecular structure of tetraethyl pyrophosphate
Toxicology (LD50):0.00 mg/Kg (guinea~pig, or); 2.000 mg/Kg(mouse, ip); 4.00 mg/Kg(mouse, or); 6.00 mg/Kg(rabbit, ct); 3.000 mg/Kg(rat, ip); 3.000 mg/Kg(rat, or); 3.00 mg/Kg(rat, or); 3.00 mg/Kg(rat, or); 0.00 mg/Kg(rat, or)

Isomers

dimethoxyphosphoryl dipropan-2-yl phosphate
Molecular structure of dimethoxyphosphoryl dipropan-2-yl phosphate
tetraethyl pyrophosphate
Molecular structure of tetraethyl pyrophosphate